Synthesis and synchrotron microcrystal structure of an aluminophosphate with chiral layers containing Lambda tris(ethylenediamine)cobalt(III)

A chiral aluminophosphate, d-Co(en)(3).Al3P4O16.3H(2)O, has been synthesized using optically pure d-Co(en)(3)(3+) as a templating agent (en = 1,2-diaminoethane). The structure of the material has been determined from a small single crystal using synchrotron radiation and imaging plate detection. The aluminophosphate contains chiral macroanionic sheets similar to those previously reported in trans-Co(dien)(2).Al3P4O16.xH(2)O (dien = diethylenetriamine). Co(C2N2H8)(3).Al3P4O16.3H(2)O, M-r = 754.1, orthorhombic, C222(1), a = 8.502(6) Angstrom, b = 14.620(6) Angstrom, c = 20.890(11) Angstrom, V = 2597(3) Angstrom(3), Z = 4, rho(calc) = 1.929 g cm(-3), rho(abs) = 1.95 g cm(-3), lambda = 1.2007(5) Angstrom, mu = 9.389 mm(-1), F(000) = 1526, T = 293 K, R-F = 0.084 for 872 reflections I > 2 sigma(I).