Synthesis of a novel two-dimensional antimony sulfide, [C4H10N](2)[Sb8S13]center dot 0.15H(2)O, and its structure solution using synchrotron imaging plate data

A novel antimony sulfide, [C4H10N](2)[Sb8S13]. 0.15H(2)O, was synthesized hydrothermally, and its structure was determined from data collected using a synchrotron/imaging plate system. The new compound consists of centrosymmetric Sb16S264- planar clusters. Each cluster is connected to four others through two edge-sharing and two corner-sharing SbS3 pyramids, forming an extended sheet. The protonated pyrrolidine molecules reside between the parallel stacked sheets. The structure is triclinic (space group <P(1)over bar>) with a = 6.929(2) Angstrom, b = 16.747(2) Angstrom, c = 17.976(4) Angstrom, alpha = 94.84(1 degrees), beta = 95.41(1)degrees, and gamma = 125.28(1)degrees.