Novel layered lead(II) aminodiphosphonates with carboxylate-sulfonate and 1,3,5-benzenetricarboxylate ligands as pendant groups or intercalated species

The hydrothermal reaction of lead(II) carbonate with 3-sulfobenzoic acid, 3-HO3S-C6H4-CO2H, and isopropylimino-bis(methylenephosphonic acid), (CH3)(2)CHN(CH2PO3H2)(2) (H4L1), gave a new layered lead(II) carboxylate-phosphonate, Pb-7((3)-O3S-C6H4-CO2)(L-1)(3)(H2O)(2)(.)2H(2)O (1), whereas the hydrothermal reaction of lead(II) carbonate with 1, 3,5-benzenetricarboxylic acid (H3BTC) and N-cyclohexylimino-bis(methylenephosphonic acid), C6H11N(CH2PO3H2)(2) (H4L2), afforded a layered complex, Pb-3(HL2)(H2L2)(H2BTC)(H2O)(H3BTCH2O)-H-.-H-. (2). The structure of complex 1 contains <010> lead(II) carboxylate-phosphonate hybrid layers, with the sulfonate group of the carboxylate-sulfonate ligand as the pendant group. In complex 2, the lead(II) ions are interconnected through bridging diphosphonate ligands, and results in the formation of a lead(II) diphosphonate slab, which are further interlinked via hydrogen bonds between non-coordinated phosphonate oxygen atoms to form a <001> layer. The doubly protonated H2BTC anion is bidentately chelated to a lead(II) ion through a carboxylate group, whereas the neutral H3BTC ligand is intercalated between two layers, forming hydrogen bonds with the non-coordinated carboxylate groups of the H2BTC anion. (C) Wiley-VCH Verlag GmbH & Co. KGaA, 69451 Weinheim, Germany, 2004.